C20H14F7N5O2 — CID 170271307
propan-2-yl (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(2-fluoro-4-pyridinyl)prop-2-enoate (PubChem CID 170271307) has the molecular formula C20H14F7N5O2 and a molecular weight of 489.35 g/mol. Its IUPAC name is propan-2-yl (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(2-fluoro-4-pyridinyl)prop-2-enoate.
| Compound Name | propan-2-yl (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(2-fluoro-4-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 170271307 |
| Molecular Formula | C20H14F7N5O2 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | propan-2-yl (E)-3-[3-[2,6-bis(trifluoromethyl)-4-pyridinyl]-1,2,4-triazol-1-yl]-2-(2-fluoro-4-pyridinyl)prop-2-enoate |
| SMILES | CC(C)OC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)nc(C(F)(F)F)c2)n1)c1ccnc(F)c1 |
| InChI | InChI=1S/C20H14F7N5O2/c1-10(2)34-18(33)13(11-3-4-28-16(21)7-11)8-32-9-29-17(31-32)12-5-14(19(22,23)24)30-15(6-12)20(25,26)27/h3-10H,1-2H3/b13-8+ |
| InChIKey | WJJOLHGLBKTLOI-MDWZMJQESA-N |
| XLogP | 4.86 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|