C23H21F3N6O2 — CID 170271420
propan-2-yl (E)-3-[[[amino-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]methylidene]amino]methylideneamino]-2-(5-cyano-3-pyridinyl)prop-2-enoate (PubChem CID 170271420) has the molecular formula C23H21F3N6O2 and a molecular weight of 470.46 g/mol. Its IUPAC name is propan-2-yl (E)-3-[[[amino-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]methylidene]amino]methylideneamino]-2-(5-cyano-3-pyridinyl)prop-2-enoate.
| Compound Name | propan-2-yl (E)-3-[[[amino-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]methylidene]amino]methylideneamino]-2-(5-cyano-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 170271420 |
| Molecular Formula | C23H21F3N6O2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | propan-2-yl (E)-3-[[[amino-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]methylidene]amino]methylideneamino]-2-(5-cyano-3-pyridinyl)prop-2-enoate |
| SMILES | CC(C)OC(=O)/C(=C/N=C/N=C(\N)c1cc(C2CC2)nc(C(F)(F)F)c1)c1cncc(C#N)c1 |
| InChI | InChI=1S/C23H21F3N6O2/c1-13(2)34-22(33)18(17-5-14(8-27)9-29-10-17)11-30-12-31-21(28)16-6-19(15-3-4-15)32-20(7-16)23(24,25)26/h5-7,9-13,15H,3-4H2,1-2H3,(H2,28,30,31)/b18-11+ |
| InChIKey | GZVIGRFDTXBYTE-WOJGMQOQSA-N |
| XLogP | 3.97 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|