C19H15F3N6O2 — CID 168984133
methyl (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoate (PubChem CID 168984133) has the molecular formula C19H15F3N6O2 and a molecular weight of 416.36 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoate |
|---|---|
| PubChem CID | 168984133 |
| Molecular Formula | C19H15F3N6O2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl (E)-3-[4-[2-cyclopropyl-6-(trifluoromethyl)-4-pyridinyl]triazol-2-yl]-2-pyrimidin-5-ylprop-2-enoate |
| SMILES | COC(=O)/C(=C/n1ncc(-c2cc(C3CC3)nc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C19H15F3N6O2/c1-30-18(29)14(13-6-23-10-24-7-13)9-28-25-8-16(27-28)12-4-15(11-2-3-11)26-17(5-12)19(20,21)22/h4-11H,2-3H2,1H3/b14-9+ |
| InChIKey | YGXHUQXNYFWLID-NTEUORMPSA-N |
| XLogP | 3.20 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|