C21H22Cl2F3N2O5P — CID 170275932
[1-[4-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-(trifluoromethyl)anilino]-4-methyl-1-oxopentan-2-yl]phosphonic acid (PubChem CID 170275932) has the molecular formula C21H22Cl2F3N2O5P and a molecular weight of 541.29 g/mol. Its IUPAC name is [1-[4-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-(trifluoromethyl)anilino]-4-methyl-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [1-[4-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-(trifluoromethyl)anilino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 170275932 |
| Molecular Formula | C21H22Cl2F3N2O5P |
| Molecular Weight | 541.29 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | [1-[4-[[2-(3,4-dichlorophenyl)acetyl]amino]-3-(trifluoromethyl)anilino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
| SMILES | CC(C)CC(C(=O)Nc1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1)P(=O)(O)O |
| InChI | InChI=1S/C21H22Cl2F3N2O5P/c1-11(2)7-18(34(31,32)33)20(30)27-13-4-6-17(14(10-13)21(24,25)26)28-19(29)9-12-3-5-15(22)16(23)8-12/h3-6,8,10-11,18H,7,9H2,1-2H3,(H,27,30)(H,28,29)(H2,31,32,33) |
| InChIKey | JBDLKPOJGAAPJH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.29 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|