C20H24Cl2N3O5P — CID 170276024
[(2S)-1-[[(2S)-1-(3,4-dichloroanilino)-1-oxo-3-pyridin-3-ylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid (PubChem CID 170276024) has the molecular formula C20H24Cl2N3O5P and a molecular weight of 488.31 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-1-(3,4-dichloroanilino)-1-oxo-3-pyridin-3-ylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid.
| Compound Name | [(2S)-1-[[(2S)-1-(3,4-dichloroanilino)-1-oxo-3-pyridin-3-ylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 170276024 |
| Molecular Formula | C20H24Cl2N3O5P |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | [(2S)-1-[[(2S)-1-(3,4-dichloroanilino)-1-oxo-3-pyridin-3-ylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]phosphonic acid |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](Cc1cccnc1)C(=O)Nc1ccc(Cl)c(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C20H24Cl2N3O5P/c1-12(2)8-18(31(28,29)30)20(27)25-17(9-13-4-3-7-23-11-13)19(26)24-14-5-6-15(21)16(22)10-14/h3-7,10-12,17-18H,8-9H2,1-2H3,(H,24,26)(H,25,27)(H2,28,29,30)/t17-,18-/m0/s1 |
| InChIKey | UDPOBNFVGZPZHZ-ROUUACIJSA-N |
| XLogP | 3.65 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|