C46H32O6 — CID 170276412
4-cyclohepta-1,4,6-trien-1-yl-6-[10-[[3-(4-hydroxyphenyl)dibenzofuran-1-yl]methyl]anthracen-9-yl]benzene-1,2,3,5-tetrol (PubChem CID 170276412) has the molecular formula C46H32O6 and a molecular weight of 680.76 g/mol. Its IUPAC name is 4-cyclohepta-1,4,6-trien-1-yl-6-[10-[[3-(4-hydroxyphenyl)dibenzofuran-1-yl]methyl]anthracen-9-yl]benzene-1,2,3,5-tetrol.
| Compound Name | 4-cyclohepta-1,4,6-trien-1-yl-6-[10-[[3-(4-hydroxyphenyl)dibenzofuran-1-yl]methyl]anthracen-9-yl]benzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 170276412 |
| Molecular Formula | C46H32O6 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 4-cyclohepta-1,4,6-trien-1-yl-6-[10-[[3-(4-hydroxyphenyl)dibenzofuran-1-yl]methyl]anthracen-9-yl]benzene-1,2,3,5-tetrol |
| SMILES | Oc1ccc(-c2cc(Cc3c4ccccc4c(-c4c(O)c(O)c(O)c(C5=CCC=CC=C5)c4O)c4ccccc34)c3c(c2)oc2ccccc23)cc1 |
| InChI | InChI=1S/C46H32O6/c47-30-21-19-26(20-22-30)28-23-29(39-35-17-9-10-18-37(35)52-38(39)25-28)24-36-31-13-5-7-15-33(31)41(34-16-8-6-14-32(34)36)42-43(48)40(44(49)46(51)45(42)50)27-11-3-1-2-4-12-27/h1-3,5-23,25,47-51H,4,24H2 |
| InChIKey | MVYBLJMZYSOPMU-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|