C20H26ClN5S — CID 170279708
4-(4-chlorophenyl)-N-(1-methylpiperidin-3-yl)-6-methylsulfanyl-7,8-dihydro-5H-pyrido[3,4-d]pyridazin-1-amine (PubChem CID 170279708) has the molecular formula C20H26ClN5S and a molecular weight of 403.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1-methylpiperidin-3-yl)-6-methylsulfanyl-7,8-dihydro-5H-pyrido[3,4-d]pyridazin-1-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(1-methylpiperidin-3-yl)-6-methylsulfanyl-7,8-dihydro-5H-pyrido[3,4-d]pyridazin-1-amine |
|---|---|
| PubChem CID | 170279708 |
| Molecular Formula | C20H26ClN5S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1-methylpiperidin-3-yl)-6-methylsulfanyl-7,8-dihydro-5H-pyrido[3,4-d]pyridazin-1-amine |
| SMILES | CSN1CCc2c(NC3CCCN(C)C3)nnc(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C20H26ClN5S/c1-25-10-3-4-16(12-25)22-20-17-9-11-26(27-2)13-18(17)19(23-24-20)14-5-7-15(21)8-6-14/h5-8,16H,3-4,9-13H2,1-2H3,(H,22,24) |
| InChIKey | ZBGQJUMSVAESQP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|