C44H36O10 — CID 170285806
6-[7-methyl-6-[6-methyl-2-[10-(2,3,4,5,6-pentahydroxyphenyl)-3,4-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]naphthalen-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 170285806) has the molecular formula C44H36O10 and a molecular weight of 724.76 g/mol. Its IUPAC name is 6-[7-methyl-6-[6-methyl-2-[10-(2,3,4,5,6-pentahydroxyphenyl)-3,4-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]naphthalen-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[7-methyl-6-[6-methyl-2-[10-(2,3,4,5,6-pentahydroxyphenyl)-3,4-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]naphthalen-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 170285806 |
| Molecular Formula | C44H36O10 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 724.23 |
| IUPAC Name | 6-[7-methyl-6-[6-methyl-2-[10-(2,3,4,5,6-pentahydroxyphenyl)-3,4-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-yl]naphthalen-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Cc1cc2cc(-c3c(O)c(O)c(O)c(O)c3O)ccc2cc1C1=C(c2c3c(c(-c4c(O)c(O)c(O)c(O)c4O)c4ccccc24)CCC=C3)C=CCC1C |
| InChI | InChI=1S/C44H36O10/c1-19-8-7-13-28(30(19)29-18-21-14-15-22(17-23(21)16-20(29)2)31-35(45)39(49)43(53)40(50)36(31)46)32-24-9-3-5-11-26(24)33(27-12-6-4-10-25(27)32)34-37(47)41(51)44(54)42(52)38(34)48/h3-5,7,9-11,13-19,45-54H,6,8,12H2,1-2H3 |
| InChIKey | ROEGNWMKXIYNJN-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|