C22H28O4 — CID 170294844
5-[3-(3,4-dimethoxy-5-methylphenyl)pentan-2-yl]-2-hydroxy-3-methylbenzaldehyde (PubChem CID 170294844) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 5-[3-(3,4-dimethoxy-5-methylphenyl)pentan-2-yl]-2-hydroxy-3-methylbenzaldehyde.
| Compound Name | 5-[3-(3,4-dimethoxy-5-methylphenyl)pentan-2-yl]-2-hydroxy-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 170294844 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 5-[3-(3,4-dimethoxy-5-methylphenyl)pentan-2-yl]-2-hydroxy-3-methylbenzaldehyde |
| SMILES | CCC(c1cc(C)c(OC)c(OC)c1)C(C)c1cc(C)c(O)c(C=O)c1 |
| InChI | InChI=1S/C22H28O4/c1-7-19(17-9-14(3)22(26-6)20(11-17)25-5)15(4)16-8-13(2)21(24)18(10-16)12-23/h8-12,15,19,24H,7H2,1-6H3 |
| InChIKey | VYBSHEGRZBTSPC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|