C20H28ClFN2O2 — CID 170305898
tert-butyl N-[2-[but-3-enyl-[1-(3-chloro-2-fluorophenyl)cyclopropyl]amino]ethyl]carbamate (PubChem CID 170305898) has the molecular formula C20H28ClFN2O2 and a molecular weight of 382.91 g/mol. Its IUPAC name is tert-butyl N-[2-[but-3-enyl-[1-(3-chloro-2-fluorophenyl)cyclopropyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[but-3-enyl-[1-(3-chloro-2-fluorophenyl)cyclopropyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 170305898 |
| Molecular Formula | C20H28ClFN2O2 |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | tert-butyl N-[2-[but-3-enyl-[1-(3-chloro-2-fluorophenyl)cyclopropyl]amino]ethyl]carbamate |
| SMILES | C=CCCN(CCNC(=O)OC(C)(C)C)C1(c2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C20H28ClFN2O2/c1-5-6-13-24(14-12-23-18(25)26-19(2,3)4)20(10-11-20)15-8-7-9-16(21)17(15)22/h5,7-9H,1,6,10-14H2,2-4H3,(H,23,25) |
| InChIKey | NRMRYRGMCAQWCX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|