C28H45NO3 — CID 170306048
4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methyl-1,2-oxazolidin-2-yl)pentan-1-one (PubChem CID 170306048) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methyl-1,2-oxazolidin-2-yl)pentan-1-one.
| Compound Name | 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methyl-1,2-oxazolidin-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 170306048 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | 4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-(4-methyl-1,2-oxazolidin-2-yl)pentan-1-one |
| SMILES | CC1CON(C(=O)CCC(C)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)C1 |
| InChI | InChI=1S/C28H45NO3/c1-18-16-29(32-17-18)26(31)10-5-19(2)23-8-9-24-22-7-6-20-15-21(30)11-13-27(20,3)25(22)12-14-28(23,24)4/h6,18-19,21-25,30H,5,7-17H2,1-4H3/t18?,19?,21-,22-,23+,24-,25-,27-,28+/m0/s1 |
| InChIKey | HLWAZIHOCRRZKQ-YDYXTMGGSA-N |
| XLogP | 5.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|