C29H31ClN2O7S — CID 170308557
ethyl 5-[[4-[2-[acetyl(furan-2-ylmethyl)amino]-2-chloroethyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 170308557) has the molecular formula C29H31ClN2O7S and a molecular weight of 587.09 g/mol. Its IUPAC name is ethyl 5-[[4-[2-[acetyl(furan-2-ylmethyl)amino]-2-chloroethyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[[4-[2-[acetyl(furan-2-ylmethyl)amino]-2-chloroethyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 170308557 |
| Molecular Formula | C29H31ClN2O7S |
| Molecular Weight | 587.09 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | ethyl 5-[[4-[2-[acetyl(furan-2-ylmethyl)amino]-2-chloroethyl]phenyl]-ethylsulfamoyl]-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(S(=O)(=O)N(CC)c3ccc(CC(Cl)N(Cc4ccco4)C(C)=O)cc3)cc2c1C |
| InChI | InChI=1S/C29H31ClN2O7S/c1-5-32(40(35,36)24-13-14-26-25(17-24)19(3)28(39-26)29(34)37-6-2)22-11-9-21(10-12-22)16-27(30)31(20(4)33)18-23-8-7-15-38-23/h7-15,17,27H,5-6,16,18H2,1-4H3 |
| InChIKey | NXGVOTAWRMDPOL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 110.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.09 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|