C34H47F2N5O5S — CID 170309760
6-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-morpholin-4-ylphthalazin-1-yl]oxyhexyl ethanesulfonate (PubChem CID 170309760) has the molecular formula C34H47F2N5O5S and a molecular weight of 675.84 g/mol. Its IUPAC name is 6-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-morpholin-4-ylphthalazin-1-yl]oxyhexyl ethanesulfonate.
| Compound Name | 6-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-morpholin-4-ylphthalazin-1-yl]oxyhexyl ethanesulfonate |
|---|---|
| PubChem CID | 170309760 |
| Molecular Formula | C34H47F2N5O5S |
| Molecular Weight | 675.84 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | 6-[4-[1-[3-[difluoro(piperidin-4-yl)methyl]phenyl]ethylamino]-7-morpholin-4-ylphthalazin-1-yl]oxyhexyl ethanesulfonate |
| SMILES | CCS(=O)(=O)OCCCCCCOc1nnc(NC(C)c2cccc(C(F)(F)C3CCNCC3)c2)c2ccc(N3CCOCC3)cc12 |
| InChI | InChI=1S/C34H47F2N5O5S/c1-3-47(42,43)46-20-7-5-4-6-19-45-33-31-24-29(41-17-21-44-22-18-41)11-12-30(31)32(39-40-33)38-25(2)26-9-8-10-28(23-26)34(35,36)27-13-15-37-16-14-27/h8-12,23-25,27,37H,3-7,13-22H2,1-2H3,(H,38,39) |
| InChIKey | HXWOGNQZQQGONM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.84 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|