C30H64O5 — CID 170309971
3,3-diethyloctane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-triethylhexanoic acid (PubChem CID 170309971) has the molecular formula C30H64O5 and a molecular weight of 504.84 g/mol. Its IUPAC name is 3,3-diethyloctane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-triethylhexanoic acid.
| Compound Name | 3,3-diethyloctane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-triethylhexanoic acid |
|---|---|
| PubChem CID | 170309971 |
| Molecular Formula | C30H64O5 |
| Molecular Weight | 504.84 g/mol |
| Exact Mass | 504.48 |
| IUPAC Name | 3,3-diethyloctane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-triethylhexanoic acid |
| SMILES | CCC(CO)(CO)CO.CCCC(CC)C(CC)(CC)C(=O)O.CCCCCC(CC)(CC)CC |
| InChI | InChI=1S/C12H24O2.C12H26.C6H14O3/c1-5-9-10(6-2)12(7-3,8-4)11(13)14;1-5-9-10-11-12(6-2,7-3)8-4;1-2-6(3-7,4-8)5-9/h10H,5-9H2,1-4H3,(H,13,14);5-11H2,1-4H3;7-9H,2-5H2,1H3 |
| InChIKey | MRCQKYXXEOINER-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.84 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|