About 6-oct-5-en-4-ylquinoline
6-oct-5-en-4-ylquinoline (PubChem CID 170319813) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 6-oct-5-en-4-ylquinoline.
Molecular Properties
| Compound Name | 6-oct-5-en-4-ylquinoline |
| PubChem CID | 170319813 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 6-oct-5-en-4-ylquinoline |
| SMILES | CCC=CC(CCC)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H21N/c1-3-5-8-14(7-4-2)15-10-11-17-16(13-15)9-6-12-18-17/h5-6,8-14H,3-4,7H2,1-2H3 |
| InChIKey | HXBLICFYUYRQJI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-oct-5-en-4-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oct-5-en-4-ylquinoline?
The IUPAC name of 6-oct-5-en-4-ylquinoline (CID 170319813) is 6-oct-5-en-4-ylquinoline.
What is the SMILES notation for 6-oct-5-en-4-ylquinoline?
The canonical SMILES for 6-oct-5-en-4-ylquinoline is CCC=CC(CCC)c1ccc2ncccc2c1.
What is the InChIKey of 6-oct-5-en-4-ylquinoline?
The InChIKey is HXBLICFYUYRQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-3-5-8-14(7-4-2)15-10-11-17-16(13-15)9-6-12-18-17/h5-6,8-14H,3-4,7H2,1-2H3.
What are the key properties of 6-oct-5-en-4-ylquinoline?
6-oct-5-en-4-ylquinoline has a molecular weight of 239.36 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oct-5-en-4-ylquinoline is sourced from PubChem (CID 170319813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).