C20H38BrN4O5S+ — CID 170327576
[3-bromo-1-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium (PubChem CID 170327576) has the molecular formula C20H38BrN4O5S+ and a molecular weight of 526.52 g/mol. Its IUPAC name is [3-bromo-1-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium.
| Compound Name | [3-bromo-1-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium |
|---|---|
| PubChem CID | 170327576 |
| Molecular Formula | C20H38BrN4O5S+ |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | [3-bromo-1-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium |
| SMILES | CC[N+](CC)(Cc1cc(Br)nn1C(C)(C)CNC(=O)OC(C)(C)C)C(C)OS(C)(=O)=O |
| InChI | InChI=1S/C20H37BrN4O5S/c1-10-25(11-2,15(3)30-31(9,27)28)13-16-12-17(21)23-24(16)20(7,8)14-22-18(26)29-19(4,5)6/h12,15H,10-11,13-14H2,1-9H3/p+1 |
| InChIKey | JXYRAJHLFUNJIM-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|