C21H39BrN4O6S — CID 177001823
[3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)ethyl]pyrazol-5-yl]methyl-triethylazanium;methanesulfonate (PubChem CID 177001823) has the molecular formula C21H39BrN4O6S and a molecular weight of 555.54 g/mol. Its IUPAC name is [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)ethyl]pyrazol-5-yl]methyl-triethylazanium;methanesulfonate.
| Compound Name | [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)ethyl]pyrazol-5-yl]methyl-triethylazanium;methanesulfonate |
|---|---|
| PubChem CID | 177001823 |
| Molecular Formula | C21H39BrN4O6S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)ethyl]pyrazol-5-yl]methyl-triethylazanium;methanesulfonate |
| SMILES | CC[N+](CC)(CC)Cc1cc(Br)nn1CC(NC(=O)OC(C)(C)C)C1COC1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H35BrN4O3.CH4O3S/c1-7-25(8-2,9-3)12-16-10-18(21)23-24(16)11-17(15-13-27-14-15)22-19(26)28-20(4,5)6;1-5(2,3)4/h10,15,17H,7-9,11-14H2,1-6H3;1H3,(H,2,3,4) |
| InChIKey | HFZYNALYINTEGC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|