C19H36BrN4O5S+ — CID 170328111
[3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium (PubChem CID 170328111) has the molecular formula C19H36BrN4O5S+ and a molecular weight of 512.49 g/mol. Its IUPAC name is [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium.
| Compound Name | [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium |
|---|---|
| PubChem CID | 170328111 |
| Molecular Formula | C19H36BrN4O5S+ |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | [3-bromo-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-5-yl]methyl-diethyl-(1-methylsulfonyloxyethyl)azanium |
| SMILES | CC[N+](CC)(Cc1cc(Br)nn1CC(C)NC(=O)OC(C)(C)C)C(C)OS(C)(=O)=O |
| InChI | InChI=1S/C19H35BrN4O5S/c1-9-24(10-2,15(4)29-30(8,26)27)13-16-11-17(20)22-23(16)12-14(3)21-18(25)28-19(5,6)7/h11,14-15H,9-10,12-13H2,1-8H3/p+1 |
| InChIKey | URLLOZABCZAYLL-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|