C11H14N2O — CID 170328676
2-propan-2-yl-1,2-benzoxazin-5-amine (PubChem CID 170328676) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-propan-2-yl-1,2-benzoxazin-5-amine.
| Compound Name | 2-propan-2-yl-1,2-benzoxazin-5-amine |
|---|---|
| PubChem CID | 170328676 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-propan-2-yl-1,2-benzoxazin-5-amine |
| SMILES | CC(C)N1C=Cc2c(N)cccc2O1 |
| InChI | InChI=1S/C11H14N2O/c1-8(2)13-7-6-9-10(12)4-3-5-11(9)14-13/h3-8H,12H2,1-2H3 |
| InChIKey | PMGISSXEEXGYIV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|