C19H22ClF2N2O5PS — CID 170339044
(2R)-N-[3-chloro-4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-3-methylbutanamide (PubChem CID 170339044) has the molecular formula C19H22ClF2N2O5PS and a molecular weight of 494.88 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-3-methylbutanamide.
| Compound Name | (2R)-N-[3-chloro-4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 170339044 |
| Molecular Formula | C19H22ClF2N2O5PS |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | (2R)-N-[3-chloro-4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](CO)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(OC(F)(F)P)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClF2N2O5PS/c1-11(2)15(10-25)18(26)23-12-6-7-17(16(20)9-12)31(27,28)24-13-4-3-5-14(8-13)29-19(21,22)30/h3-9,11,15,24-25H,10,30H2,1-2H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | XJQHFQCYNLQAAZ-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|