C33H30N2O3 — CID 170339375
3-benzyl-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]benzamide (PubChem CID 170339375) has the molecular formula C33H30N2O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is 3-benzyl-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]benzamide.
| Compound Name | 3-benzyl-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 170339375 |
| Molecular Formula | C33H30N2O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 3-benzyl-2-[[(1R)-1-(3,6-dimethyl-4-oxo-2-phenylchromen-8-yl)ethyl]amino]benzamide |
| SMILES | Cc1cc([C@@H](C)Nc2c(Cc3ccccc3)cccc2C(N)=O)c2oc(-c3ccccc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C33H30N2O3/c1-20-17-27(32-28(18-20)30(36)21(2)31(38-32)24-13-8-5-9-14-24)22(3)35-29-25(15-10-16-26(29)33(34)37)19-23-11-6-4-7-12-23/h4-18,22,35H,19H2,1-3H3,(H2,34,37)/t22-/m1/s1 |
| InChIKey | RWDLRXDNZXBLIF-JOCHJYFZSA-N |
| XLogP | 6.94 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |