C21H15Cl2N7O5S — CID 170341624
2-[3,5-dichloro-4-[4-(1,1-dioxothian-4-yl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 170341624) has the molecular formula C21H15Cl2N7O5S and a molecular weight of 548.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-(1,1-dioxothian-4-yl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[4-(1,1-dioxothian-4-yl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 170341624 |
| Molecular Formula | C21H15Cl2N7O5S |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-(1,1-dioxothian-4-yl)-5-oxopyrazolo[4,5-b]pyridin-1-yl]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(-n3ncc4c3ccc(=O)n4C3CCS(=O)(=O)CC3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H15Cl2N7O5S/c22-13-7-12(29-21(33)26-20(32)15(9-24)27-29)8-14(23)19(13)30-16-1-2-18(31)28(17(16)10-25-30)11-3-5-36(34,35)6-4-11/h1-2,7-8,10-11H,3-6H2,(H,26,32,33) |
| InChIKey | YEPXHMPMJFVTOQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |