C20H14Cl2N8O3 — CID 170346657
2-[3,5-dichloro-4-(5-oxo-4-pyrrolidin-3-ylpyrazolo[4,5-b]pyridin-1-yl)phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 170346657) has the molecular formula C20H14Cl2N8O3 and a molecular weight of 485.29 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(5-oxo-4-pyrrolidin-3-ylpyrazolo[4,5-b]pyridin-1-yl)phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-(5-oxo-4-pyrrolidin-3-ylpyrazolo[4,5-b]pyridin-1-yl)phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 170346657 |
| Molecular Formula | C20H14Cl2N8O3 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-[3,5-dichloro-4-(5-oxo-4-pyrrolidin-3-ylpyrazolo[4,5-b]pyridin-1-yl)phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(-n3ncc4c3ccc(=O)n4C3CCNC3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H14Cl2N8O3/c21-12-5-11(29-20(33)26-19(32)14(7-23)27-29)6-13(22)18(12)30-15-1-2-17(31)28(16(15)9-25-30)10-3-4-24-8-10/h1-2,5-6,9-10,24H,3-4,8H2,(H,26,32,33) |
| InChIKey | ZLSBCWUILPUUOQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |