C24H21NO2 — CID 170342922
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(4-phenylphenyl)prop-2-yn-1-amine (PubChem CID 170342922) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(4-phenylphenyl)prop-2-yn-1-amine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(4-phenylphenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 170342922 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(4-phenylphenyl)prop-2-yn-1-amine |
| SMILES | C(#Cc1ccc(-c2ccccc2)cc1)CNCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21NO2/c1-2-6-21(7-3-1)22-11-8-19(9-12-22)5-4-15-25-16-14-20-10-13-23-24(17-20)27-18-26-23/h1-3,6-13,17,25H,14-16,18H2 |
| InChIKey | UTUMWGCMIBQRCT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|