C12H13FN2O4S — CID 170345405
N-(5-amino-7-fluoro-8-methyl-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)acetamide (PubChem CID 170345405) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(5-amino-7-fluoro-8-methyl-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)acetamide.
| Compound Name | N-(5-amino-7-fluoro-8-methyl-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 170345405 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(5-amino-7-fluoro-8-methyl-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)acetamide |
| SMILES | CC(=O)NC1CS(=O)(=O)c2c(C)c(F)cc(N)c2C1=O |
| InChI | InChI=1S/C12H13FN2O4S/c1-5-7(13)3-8(14)10-11(17)9(15-6(2)16)4-20(18,19)12(5)10/h3,9H,4,14H2,1-2H3,(H,15,16) |
| InChIKey | ZNEJGGWZOSZJAG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|