C12H13FN2O3S — CID 170345357
N-(5-amino-7-fluoro-8-methoxy-4-oxo-2,3-dihydrothiochromen-3-yl)acetamide (PubChem CID 170345357) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(5-amino-7-fluoro-8-methoxy-4-oxo-2,3-dihydrothiochromen-3-yl)acetamide.
| Compound Name | N-(5-amino-7-fluoro-8-methoxy-4-oxo-2,3-dihydrothiochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 170345357 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-(5-amino-7-fluoro-8-methoxy-4-oxo-2,3-dihydrothiochromen-3-yl)acetamide |
| SMILES | COc1c(F)cc(N)c2c1SCC(NC(C)=O)C2=O |
| InChI | InChI=1S/C12H13FN2O3S/c1-5(16)15-8-4-19-12-9(10(8)17)7(14)3-6(13)11(12)18-2/h3,8H,4,14H2,1-2H3,(H,15,16) |
| InChIKey | HYTZNLRPEJRUNN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|