C11H13FN2O2 — CID 170345383
5-amino-7-fluoro-8-methyl-3-(methylamino)-2,3-dihydrochromen-4-one (PubChem CID 170345383) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is 5-amino-7-fluoro-8-methyl-3-(methylamino)-2,3-dihydrochromen-4-one.
| Compound Name | 5-amino-7-fluoro-8-methyl-3-(methylamino)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 170345383 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-amino-7-fluoro-8-methyl-3-(methylamino)-2,3-dihydrochromen-4-one |
| SMILES | CNC1COc2c(C)c(F)cc(N)c2C1=O |
| InChI | InChI=1S/C11H13FN2O2/c1-5-6(12)3-7(13)9-10(15)8(14-2)4-16-11(5)9/h3,8,14H,4,13H2,1-2H3 |
| InChIKey | RHSCSTCQFUYZEF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|