C25H28F3N3O3 — CID 19434912
5-amino-6,8-difluoro-2-[3-fluoro-4-(6-morpholin-4-ylhexylamino)phenyl]chromen-4-one (PubChem CID 19434912) has the molecular formula C25H28F3N3O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 5-amino-6,8-difluoro-2-[3-fluoro-4-(6-morpholin-4-ylhexylamino)phenyl]chromen-4-one.
| Compound Name | 5-amino-6,8-difluoro-2-[3-fluoro-4-(6-morpholin-4-ylhexylamino)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 19434912 |
| Molecular Formula | C25H28F3N3O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 5-amino-6,8-difluoro-2-[3-fluoro-4-(6-morpholin-4-ylhexylamino)phenyl]chromen-4-one |
| SMILES | Nc1c(F)cc(F)c2oc(-c3ccc(NCCCCCCN4CCOCC4)c(F)c3)cc(=O)c12 |
| InChI | InChI=1S/C25H28F3N3O3/c26-17-13-16(22-15-21(32)23-24(29)18(27)14-19(28)25(23)34-22)5-6-20(17)30-7-3-1-2-4-8-31-9-11-33-12-10-31/h5-6,13-15,30H,1-4,7-12,29H2 |
| InChIKey | IQLZHYPMOVBCFX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|