C22H22F3N3O3 — CID 19434829
2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(3-morpholin-4-ylpropylamino)chromen-4-one (PubChem CID 19434829) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(3-morpholin-4-ylpropylamino)chromen-4-one.
| Compound Name | 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(3-morpholin-4-ylpropylamino)chromen-4-one |
|---|---|
| PubChem CID | 19434829 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-(4-amino-3-fluorophenyl)-6,8-difluoro-5-(3-morpholin-4-ylpropylamino)chromen-4-one |
| SMILES | Nc1ccc(-c2cc(=O)c3c(NCCCN4CCOCC4)c(F)cc(F)c3o2)cc1F |
| InChI | InChI=1S/C22H22F3N3O3/c23-14-10-13(2-3-17(14)26)19-12-18(29)20-21(15(24)11-16(25)22(20)31-19)27-4-1-5-28-6-8-30-9-7-28/h2-3,10-12,27H,1,4-9,26H2 |
| InChIKey | NWMMIRHBVLMRPC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|