C13H15FN2O2 — CID 175980560
2-(8-amino-6-fluoro-5-methyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetamide (PubChem CID 175980560) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-(8-amino-6-fluoro-5-methyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetamide.
| Compound Name | 2-(8-amino-6-fluoro-5-methyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 175980560 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(8-amino-6-fluoro-5-methyl-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetamide |
| SMILES | Cc1c(F)cc(N)c2c1CCC(CC(N)=O)C2=O |
| InChI | InChI=1S/C13H15FN2O2/c1-6-8-3-2-7(4-11(16)17)13(18)12(8)10(15)5-9(6)14/h5,7H,2-4,15H2,1H3,(H2,16,17) |
| InChIKey | ANACDNIQHCYEDW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|