C37H38ClFN4O5 — CID 170346649
ethyl 3-[bis[(4-methoxyphenyl)methyl]amino]-2-chloro-5-fluoro-6-[5-methyl-1-(oxan-2-yl)indazol-4-yl]pyridine-4-carboxylate (PubChem CID 170346649) has the molecular formula C37H38ClFN4O5 and a molecular weight of 673.19 g/mol. Its IUPAC name is ethyl 3-[bis[(4-methoxyphenyl)methyl]amino]-2-chloro-5-fluoro-6-[5-methyl-1-(oxan-2-yl)indazol-4-yl]pyridine-4-carboxylate.
| Compound Name | ethyl 3-[bis[(4-methoxyphenyl)methyl]amino]-2-chloro-5-fluoro-6-[5-methyl-1-(oxan-2-yl)indazol-4-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 170346649 |
| Molecular Formula | C37H38ClFN4O5 |
| Molecular Weight | 673.19 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | ethyl 3-[bis[(4-methoxyphenyl)methyl]amino]-2-chloro-5-fluoro-6-[5-methyl-1-(oxan-2-yl)indazol-4-yl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c(F)c(-c2c(C)ccc3c2cnn3C2CCCCO2)nc(Cl)c1N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C37H38ClFN4O5/c1-5-47-37(44)32-33(39)34(31-23(2)9-18-29-28(31)20-40-43(29)30-8-6-7-19-48-30)41-36(38)35(32)42(21-24-10-14-26(45-3)15-11-24)22-25-12-16-27(46-4)17-13-25/h9-18,20,30H,5-8,19,21-22H2,1-4H3 |
| InChIKey | AXOQIAUGTVLEIV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.19 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|