C18H19ClIN5O — CID 176655147
N-(6-chloro-5-iodo-2-methylpyrimidin-4-yl)-5-methyl-1-(oxan-2-yl)indazol-4-amine (PubChem CID 176655147) has the molecular formula C18H19ClIN5O and a molecular weight of 483.74 g/mol. Its IUPAC name is N-(6-chloro-5-iodo-2-methylpyrimidin-4-yl)-5-methyl-1-(oxan-2-yl)indazol-4-amine.
| Compound Name | N-(6-chloro-5-iodo-2-methylpyrimidin-4-yl)-5-methyl-1-(oxan-2-yl)indazol-4-amine |
|---|---|
| PubChem CID | 176655147 |
| Molecular Formula | C18H19ClIN5O |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | N-(6-chloro-5-iodo-2-methylpyrimidin-4-yl)-5-methyl-1-(oxan-2-yl)indazol-4-amine |
| SMILES | Cc1nc(Cl)c(I)c(Nc2c(C)ccc3c2cnn3C2CCCCO2)n1 |
| InChI | InChI=1S/C18H19ClIN5O/c1-10-6-7-13-12(9-21-25(13)14-5-3-4-8-26-14)16(10)24-18-15(20)17(19)22-11(2)23-18/h6-7,9,14H,3-5,8H2,1-2H3,(H,22,23,24) |
| InChIKey | ZUQDEXMONXXCND-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|