C26H29ClN4O4 — CID 170351235
tert-butyl 6-[6-chloro-3-[2-(methoxymethoxy)phenyl]cinnolin-7-yl]-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 170351235) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is tert-butyl 6-[6-chloro-3-[2-(methoxymethoxy)phenyl]cinnolin-7-yl]-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[6-chloro-3-[2-(methoxymethoxy)phenyl]cinnolin-7-yl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170351235 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | tert-butyl 6-[6-chloro-3-[2-(methoxymethoxy)phenyl]cinnolin-7-yl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | COCOc1ccccc1-c1cc2cc(Cl)c(N3CC4(CN(C(=O)OC(C)(C)C)C4)C3)cc2nn1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-25(2,3)35-24(32)31-14-26(15-31)12-30(13-26)22-11-20-17(9-19(22)27)10-21(29-28-20)18-7-5-6-8-23(18)34-16-33-4/h5-11H,12-16H2,1-4H3 |
| InChIKey | AHCIWAJAESSADZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|