C26H29N7O — CID 170352257
7-(3,3-dimethylbut-1-ynyl)-5-[2-[[1-(oxan-2-yl)pyrazol-3-yl]amino]-4-pyridinyl]-1H-indazol-3-amine (PubChem CID 170352257) has the molecular formula C26H29N7O and a molecular weight of 455.57 g/mol. Its IUPAC name is 7-(3,3-dimethylbut-1-ynyl)-5-[2-[[1-(oxan-2-yl)pyrazol-3-yl]amino]-4-pyridinyl]-1H-indazol-3-amine.
| Compound Name | 7-(3,3-dimethylbut-1-ynyl)-5-[2-[[1-(oxan-2-yl)pyrazol-3-yl]amino]-4-pyridinyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 170352257 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 7-(3,3-dimethylbut-1-ynyl)-5-[2-[[1-(oxan-2-yl)pyrazol-3-yl]amino]-4-pyridinyl]-1H-indazol-3-amine |
| SMILES | CC(C)(C)C#Cc1cc(-c2ccnc(Nc3ccn(C4CCCCO4)n3)c2)cc2c(N)n[nH]c12 |
| InChI | InChI=1S/C26H29N7O/c1-26(2,3)10-7-18-14-19(15-20-24(18)30-31-25(20)27)17-8-11-28-22(16-17)29-21-9-12-33(32-21)23-6-4-5-13-34-23/h8-9,11-12,14-16,23H,4-6,13H2,1-3H3,(H3,27,30,31)(H,28,29,32) |
| InChIKey | GVJDSFBBBKXBMH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|