C25H24N6O — CID 170352100
1-[4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]-3-phenylurea (PubChem CID 170352100) has the molecular formula C25H24N6O and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-[4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]-3-phenylurea.
| Compound Name | 1-[4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]-3-phenylurea |
|---|---|
| PubChem CID | 170352100 |
| Molecular Formula | C25H24N6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]-3-phenylurea |
| SMILES | CC(C)(C)C#Cc1cc(-c2ccnc(NC(=O)Nc3ccccc3)c2)cc2c(N)n[nH]c12 |
| InChI | InChI=1S/C25H24N6O/c1-25(2,3)11-9-17-13-18(14-20-22(17)30-31-23(20)26)16-10-12-27-21(15-16)29-24(32)28-19-7-5-4-6-8-19/h4-8,10,12-15H,1-3H3,(H3,26,30,31)(H2,27,28,29,32) |
| InChIKey | WLNMPGQONGPPIB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|