C23H26N6O3 — CID 170422434
methyl N-[4-[3-amino-7-(5-morpholin-4-ylpent-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamate (PubChem CID 170422434) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is methyl N-[4-[3-amino-7-(5-morpholin-4-ylpent-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-[3-amino-7-(5-morpholin-4-ylpent-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170422434 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | methyl N-[4-[3-amino-7-(5-morpholin-4-ylpent-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1cc(-c2cc(C#CCCCN3CCOCC3)c3[nH]nc(N)c3c2)ccn1 |
| InChI | InChI=1S/C23H26N6O3/c1-31-23(30)26-20-15-16(6-7-25-20)18-13-17(21-19(14-18)22(24)28-27-21)5-3-2-4-8-29-9-11-32-12-10-29/h6-7,13-15H,2,4,8-12H2,1H3,(H3,24,27,28)(H,25,26,30) |
| InChIKey | YCPOUXYRCGGXDL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|