C26H30N6O — CID 170352179
7-(3,3-dimethylbut-1-ynyl)-5-[2-(2-morpholin-4-ylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1H-indazol-3-amine (PubChem CID 170352179) has the molecular formula C26H30N6O and a molecular weight of 442.57 g/mol. Its IUPAC name is 7-(3,3-dimethylbut-1-ynyl)-5-[2-(2-morpholin-4-ylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1H-indazol-3-amine.
| Compound Name | 7-(3,3-dimethylbut-1-ynyl)-5-[2-(2-morpholin-4-ylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 170352179 |
| Molecular Formula | C26H30N6O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 7-(3,3-dimethylbut-1-ynyl)-5-[2-(2-morpholin-4-ylethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-1H-indazol-3-amine |
| SMILES | CC(C)(C)C#Cc1cc(-c2ccnc3[nH]c(CCN4CCOCC4)cc23)cc2c(N)n[nH]c12 |
| InChI | InChI=1S/C26H30N6O/c1-26(2,3)7-4-17-14-18(15-22-23(17)30-31-24(22)27)20-5-8-28-25-21(20)16-19(29-25)6-9-32-10-12-33-13-11-32/h5,8,14-16H,6,9-13H2,1-3H3,(H,28,29)(H3,27,30,31) |
| InChIKey | CIVFMHICLOEXAO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|