C22H21N5O — CID 170352269
1-[2-[3-amino-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-indazol-7-yl]ethynyl]cyclohexan-1-ol (PubChem CID 170352269) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-[3-amino-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-indazol-7-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[3-amino-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-indazol-7-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170352269 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[2-[3-amino-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-indazol-7-yl]ethynyl]cyclohexan-1-ol |
| SMILES | Nc1n[nH]c2c(C#CC3(O)CCCCC3)cc(-c3ccnc4[nH]ccc34)cc12 |
| InChI | InChI=1S/C22H21N5O/c23-20-18-13-15(16-5-10-24-21-17(16)6-11-25-21)12-14(19(18)26-27-20)4-9-22(28)7-2-1-3-8-22/h5-6,10-13,28H,1-3,7-8H2,(H,24,25)(H3,23,26,27) |
| InChIKey | PVADXTNHDOSFMV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|