C22H21N5O2 — CID 170352350
methyl 4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate (PubChem CID 170352350) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170352350 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | methyl 4-[3-amino-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-5-yl]-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3cc(C#CC(C)(C)C)c4[nH]nc(N)c4c3)ccnc2[nH]1 |
| InChI | InChI=1S/C22H21N5O2/c1-22(2,3)7-5-12-9-13(10-16-18(12)26-27-19(16)23)14-6-8-24-20-15(14)11-17(25-20)21(28)29-4/h6,8-11H,1-4H3,(H,24,25)(H3,23,26,27) |
| InChIKey | CTFNUKOHNGGINA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|