C27H31N5 — CID 170352536
5-[2-(cyclohexylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-3-amine (PubChem CID 170352536) has the molecular formula C27H31N5 and a molecular weight of 425.58 g/mol. Its IUPAC name is 5-[2-(cyclohexylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-3-amine.
| Compound Name | 5-[2-(cyclohexylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 170352536 |
| Molecular Formula | C27H31N5 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 5-[2-(cyclohexylmethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-7-(3,3-dimethylbut-1-ynyl)-1H-indazol-3-amine |
| SMILES | CC(C)(C)C#Cc1cc(-c2ccnc3[nH]c(CC4CCCCC4)cc23)cc2c(N)n[nH]c12 |
| InChI | InChI=1S/C27H31N5/c1-27(2,3)11-9-18-14-19(15-23-24(18)31-32-25(23)28)21-10-12-29-26-22(21)16-20(30-26)13-17-7-5-4-6-8-17/h10,12,14-17H,4-8,13H2,1-3H3,(H,29,30)(H3,28,31,32) |
| InChIKey | RGXLOQYEIINTGG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|