C18H18N6O2 — CID 170351977
[4-[3-amino-7-(3-amino-3-methylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamic acid (PubChem CID 170351977) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is [4-[3-amino-7-(3-amino-3-methylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamic acid.
| Compound Name | [4-[3-amino-7-(3-amino-3-methylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 170351977 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [4-[3-amino-7-(3-amino-3-methylbut-1-ynyl)-1H-indazol-5-yl]-2-pyridinyl]carbamic acid |
| SMILES | CC(C)(N)C#Cc1cc(-c2ccnc(NC(=O)O)c2)cc2c(N)n[nH]c12 |
| InChI | InChI=1S/C18H18N6O2/c1-18(2,20)5-3-11-7-12(8-13-15(11)23-24-16(13)19)10-4-6-21-14(9-10)22-17(25)26/h4,6-9H,20H2,1-2H3,(H,21,22)(H,25,26)(H3,19,23,24) |
| InChIKey | JCYGEIIENDGJIP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|