C23H28N2O4S — CID 170355709
N-heptyl-2-[3-hydroxy-4-[(2-methyl-1,3-benzothiazol-6-yl)oxy]phenoxy]acetamide (PubChem CID 170355709) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is N-heptyl-2-[3-hydroxy-4-[(2-methyl-1,3-benzothiazol-6-yl)oxy]phenoxy]acetamide.
| Compound Name | N-heptyl-2-[3-hydroxy-4-[(2-methyl-1,3-benzothiazol-6-yl)oxy]phenoxy]acetamide |
|---|---|
| PubChem CID | 170355709 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-heptyl-2-[3-hydroxy-4-[(2-methyl-1,3-benzothiazol-6-yl)oxy]phenoxy]acetamide |
| SMILES | CCCCCCCNC(=O)COc1ccc(Oc2ccc3nc(C)sc3c2)c(O)c1 |
| InChI | InChI=1S/C23H28N2O4S/c1-3-4-5-6-7-12-24-23(27)15-28-17-9-11-21(20(26)13-17)29-18-8-10-19-22(14-18)30-16(2)25-19/h8-11,13-14,26H,3-7,12,15H2,1-2H3,(H,24,27) |
| InChIKey | XJRKWARCNWSMQP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|