C21H17ClF2N4O2 — CID 170358755
4-[4-(6-chloro-4-methyl-2,3-dioxoquinoxalin-1-yl)piperidin-1-yl]-3,5-difluorobenzonitrile (PubChem CID 170358755) has the molecular formula C21H17ClF2N4O2 and a molecular weight of 430.84 g/mol. Its IUPAC name is 4-[4-(6-chloro-4-methyl-2,3-dioxoquinoxalin-1-yl)piperidin-1-yl]-3,5-difluorobenzonitrile.
| Compound Name | 4-[4-(6-chloro-4-methyl-2,3-dioxoquinoxalin-1-yl)piperidin-1-yl]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 170358755 |
| Molecular Formula | C21H17ClF2N4O2 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 4-[4-(6-chloro-4-methyl-2,3-dioxoquinoxalin-1-yl)piperidin-1-yl]-3,5-difluorobenzonitrile |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(c3c(F)cc(C#N)cc3F)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H17ClF2N4O2/c1-26-18-10-13(22)2-3-17(18)28(21(30)20(26)29)14-4-6-27(7-5-14)19-15(23)8-12(11-25)9-16(19)24/h2-3,8-10,14H,4-7H2,1H3 |
| InChIKey | XMAQKYUYNQBGGU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|