C20H39NS — CID 170361719
[2-[(E)-4-heptan-4-ylsulfanylpent-2-enyl]cycloheptyl]methanamine (PubChem CID 170361719) has the molecular formula C20H39NS and a molecular weight of 325.61 g/mol. Its IUPAC name is [2-[(E)-4-heptan-4-ylsulfanylpent-2-enyl]cycloheptyl]methanamine.
| Compound Name | [2-[(E)-4-heptan-4-ylsulfanylpent-2-enyl]cycloheptyl]methanamine |
|---|---|
| PubChem CID | 170361719 |
| Molecular Formula | C20H39NS |
| Molecular Weight | 325.61 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | [2-[(E)-4-heptan-4-ylsulfanylpent-2-enyl]cycloheptyl]methanamine |
| SMILES | CCCC(CCC)SC(C)/C=C/CC1CCCCCC1CN |
| InChI | InChI=1S/C20H39NS/c1-4-10-20(11-5-2)22-17(3)12-9-15-18-13-7-6-8-14-19(18)16-21/h9,12,17-20H,4-8,10-11,13-16,21H2,1-3H3/b12-9+ |
| InChIKey | PQYBMZTVBPINPK-FMIVXFBMSA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|