C25H27NO6 — CID 17036355
2-(3-benzyl-1,3-oxazolidin-2-ylidene)-5-(3,4,5-trimethoxyphenyl)cyclohexane-1,3-dione (PubChem CID 17036355) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-(3-benzyl-1,3-oxazolidin-2-ylidene)-5-(3,4,5-trimethoxyphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(3-benzyl-1,3-oxazolidin-2-ylidene)-5-(3,4,5-trimethoxyphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 17036355 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-(3-benzyl-1,3-oxazolidin-2-ylidene)-5-(3,4,5-trimethoxyphenyl)cyclohexane-1,3-dione |
| SMILES | COc1cc(C2CC(=O)C(=C3OCCN3Cc3ccccc3)C(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO6/c1-29-21-13-18(14-22(30-2)24(21)31-3)17-11-19(27)23(20(28)12-17)25-26(9-10-32-25)15-16-7-5-4-6-8-16/h4-8,13-14,17H,9-12,15H2,1-3H3/b25-23- |
| InChIKey | FABMJGWAWDMFOE-BZZOAKBMSA-N |
| XLogP | 3.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|