C21H18N2O — CID 170363668
3,3,18-trimethyl-15-oxa-17,20-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16,18,20-nonaene (PubChem CID 170363668) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 3,3,18-trimethyl-15-oxa-17,20-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16,18,20-nonaene.
| Compound Name | 3,3,18-trimethyl-15-oxa-17,20-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16,18,20-nonaene |
|---|---|
| PubChem CID | 170363668 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3,3,18-trimethyl-15-oxa-17,20-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16,18,20-nonaene |
| SMILES | Cc1cnc2c(n1)OCc1ccc3c(c1-2)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C21H18N2O/c1-12-10-22-19-17-13(11-24-20(19)23-12)8-9-15-14-6-4-5-7-16(14)21(2,3)18(15)17/h4-10H,11H2,1-3H3 |
| InChIKey | VYQXBDBOXUMEDW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |