C43H31NS2 — CID 170366048
N-[(2E)-4-dibenzothiophen-4-yl-1-(9-phenyldibenzothiophen-3-yl)penta-2,4-dienyl]-1-phenylethanimine (PubChem CID 170366048) has the molecular formula C43H31NS2 and a molecular weight of 625.86 g/mol. Its IUPAC name is N-[(2E)-4-dibenzothiophen-4-yl-1-(9-phenyldibenzothiophen-3-yl)penta-2,4-dienyl]-1-phenylethanimine.
| Compound Name | N-[(2E)-4-dibenzothiophen-4-yl-1-(9-phenyldibenzothiophen-3-yl)penta-2,4-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 170366048 |
| Molecular Formula | C43H31NS2 |
| Molecular Weight | 625.86 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | N-[(2E)-4-dibenzothiophen-4-yl-1-(9-phenyldibenzothiophen-3-yl)penta-2,4-dienyl]-1-phenylethanimine |
| SMILES | C=C(/C=C/C(/N=C(\C)c1ccccc1)c1ccc2c(c1)sc1cccc(-c3ccccc3)c12)c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C43H31NS2/c1-28(33-18-11-20-36-35-17-9-10-21-39(35)46-43(33)36)23-26-38(44-29(2)30-13-5-3-6-14-30)32-24-25-37-41(27-32)45-40-22-12-19-34(42(37)40)31-15-7-4-8-16-31/h3-27,38H,1H2,2H3/b26-23+,44-29+ |
| InChIKey | QCJCSFSDOTUHJP-HIBQKVMISA-N |
| XLogP | 12.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.86 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|