C25H21NS — CID 145017001
(E)-3-dibenzothiophen-1-yl-1-phenyl-N-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 145017001) has the molecular formula C25H21NS and a molecular weight of 367.52 g/mol. Its IUPAC name is (E)-3-dibenzothiophen-1-yl-1-phenyl-N-prop-1-en-2-ylbut-2-en-1-imine.
| Compound Name | (E)-3-dibenzothiophen-1-yl-1-phenyl-N-prop-1-en-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 145017001 |
| Molecular Formula | C25H21NS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (E)-3-dibenzothiophen-1-yl-1-phenyl-N-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C=C(C)/N=C(/C=C(\C)c1cccc2sc3ccccc3c12)c1ccccc1 |
| InChI | InChI=1S/C25H21NS/c1-17(2)26-22(19-10-5-4-6-11-19)16-18(3)20-13-9-15-24-25(20)21-12-7-8-14-23(21)27-24/h4-16H,1H2,2-3H3/b18-16+,26-22- |
| InChIKey | XZPBLVXBFHWUJH-VKZUPEABSA-N |
| XLogP | 7.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|