C37H31NS — CID 145017085
(E)-3-dibenzothiophen-1-yl-N-[1-(3-methylcyclohexa-1,5-dien-1-yl)ethenyl]-1-(3-phenylphenyl)but-2-en-1-imine (PubChem CID 145017085) has the molecular formula C37H31NS and a molecular weight of 521.73 g/mol. Its IUPAC name is (E)-3-dibenzothiophen-1-yl-N-[1-(3-methylcyclohexa-1,5-dien-1-yl)ethenyl]-1-(3-phenylphenyl)but-2-en-1-imine.
| Compound Name | (E)-3-dibenzothiophen-1-yl-N-[1-(3-methylcyclohexa-1,5-dien-1-yl)ethenyl]-1-(3-phenylphenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 145017085 |
| Molecular Formula | C37H31NS |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (E)-3-dibenzothiophen-1-yl-N-[1-(3-methylcyclohexa-1,5-dien-1-yl)ethenyl]-1-(3-phenylphenyl)but-2-en-1-imine |
| SMILES | C=C(/N=C(/C=C(\C)c1cccc2sc3ccccc3c12)c1cccc(-c2ccccc2)c1)C1=CC(C)CC=C1 |
| InChI | InChI=1S/C37H31NS/c1-25-12-9-15-29(22-25)27(3)38-34(31-17-10-16-30(24-31)28-13-5-4-6-14-28)23-26(2)32-19-11-21-36-37(32)33-18-7-8-20-35(33)39-36/h4-11,13-25H,3,12H2,1-2H3/b26-23+,38-34- |
| InChIKey | WZYGJFMSXYXURQ-BTSVCLGDSA-N |
| XLogP | 10.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|