C31H37NO — CID 170371542
6-tert-butyl-3-[4-[(E)-2-[4-(2,2-dimethylpropyl)phenyl]ethenyl]phenyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 170371542) has the molecular formula C31H37NO and a molecular weight of 439.64 g/mol. Its IUPAC name is 6-tert-butyl-3-[4-[(E)-2-[4-(2,2-dimethylpropyl)phenyl]ethenyl]phenyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-tert-butyl-3-[4-[(E)-2-[4-(2,2-dimethylpropyl)phenyl]ethenyl]phenyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 170371542 |
| Molecular Formula | C31H37NO |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 6-tert-butyl-3-[4-[(E)-2-[4-(2,2-dimethylpropyl)phenyl]ethenyl]phenyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(C)(C)Cc1ccc(/C=C/c2ccc(N3COc4ccc(C(C)(C)C)cc4C3)cc2)cc1 |
| InChI | InChI=1S/C31H37NO/c1-30(2,3)20-25-11-9-23(10-12-25)7-8-24-13-16-28(17-14-24)32-21-26-19-27(31(4,5)6)15-18-29(26)33-22-32/h7-19H,20-22H2,1-6H3/b8-7+ |
| InChIKey | VOVIOODNSFCYDO-BQYQJAHWSA-N |
| XLogP | 8.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|